C8H7N3O3 — CID 107409889
4-(3-hydroxyphenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107409889) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(3-hydroxyphenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409889 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 4-(3-hydroxyphenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1cccc(O)c1 |
| InChI | InChI=1S/C8H7N3O3/c12-6-3-1-2-5(4-6)11-7(13)9-10-8(11)14/h1-4,12H,(H,9,13)(H,10,14) |
| InChIKey | BZKLHVVYOKVDNY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |