C11H14N2O2 — CID 105458800
1-(3-hydroxyphenyl)-4,4-dimethylimidazolidin-2-one (PubChem CID 105458800) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-4,4-dimethylimidazolidin-2-one.
| Compound Name | 1-(3-hydroxyphenyl)-4,4-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 105458800 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(3-hydroxyphenyl)-4,4-dimethylimidazolidin-2-one |
| SMILES | CC1(C)CN(c2cccc(O)c2)C(=O)N1 |
| InChI | InChI=1S/C11H14N2O2/c1-11(2)7-13(10(15)12-11)8-4-3-5-9(14)6-8/h3-6,14H,7H2,1-2H3,(H,12,15) |
| InChIKey | JEJUHMUJUAIYNG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |