About 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one
1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one (PubChem CID 105457673) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one |
| PubChem CID | 105457673 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one |
| SMILES | CC1(C)CN(c2ccccc2N)C(=O)N1 |
| InChI | InChI=1S/C11H15N3O/c1-11(2)7-14(10(15)13-11)9-6-4-3-5-8(9)12/h3-6H,7,12H2,1-2H3,(H,13,15) |
| InChIKey | REQWEBHRCSQDAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one?
The IUPAC name of 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one (CID 105457673) is 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one.
What is the SMILES notation for 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one?
The canonical SMILES for 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one is CC1(C)CN(c2ccccc2N)C(=O)N1.
What is the InChIKey of 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one?
The InChIKey is REQWEBHRCSQDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-11(2)7-14(10(15)13-11)9-6-4-3-5-8(9)12/h3-6H,7,12H2,1-2H3,(H,13,15).
What are the key properties of 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one?
1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one has a molecular weight of 205.26 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminophenyl)-4,4-dimethylimidazolidin-2-one is sourced from PubChem (CID 105457673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).