C12H17N3O — CID 105474458
1-(2-aminophenyl)-4,4-dimethyl-1,3-diazinan-2-one (PubChem CID 105474458) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-(2-aminophenyl)-4,4-dimethyl-1,3-diazinan-2-one.
| Compound Name | 1-(2-aminophenyl)-4,4-dimethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 105474458 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-(2-aminophenyl)-4,4-dimethyl-1,3-diazinan-2-one |
| SMILES | CC1(C)CCN(c2ccccc2N)C(=O)N1 |
| InChI | InChI=1S/C12H17N3O/c1-12(2)7-8-15(11(16)14-12)10-6-4-3-5-9(10)13/h3-6H,7-8,13H2,1-2H3,(H,14,16) |
| InChIKey | QCKTYIVNZRTIOQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|