C11H15N3O — CID 140737605
3,3-dimethyl-2,4-dihydroquinoxaline-1-carboxamide (PubChem CID 140737605) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydroquinoxaline-1-carboxamide.
| Compound Name | 3,3-dimethyl-2,4-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 140737605 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydroquinoxaline-1-carboxamide |
| SMILES | CC1(C)CN(C(N)=O)c2ccccc2N1 |
| InChI | InChI=1S/C11H15N3O/c1-11(2)7-14(10(12)15)9-6-4-3-5-8(9)13-11/h3-6,13H,7H2,1-2H3,(H2,12,15) |
| InChIKey | VORURSMFYMUHLM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |