C11H13N3O2 — CID 143013487
(3S)-5-acetyl-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 143013487) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is (3S)-5-acetyl-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | (3S)-5-acetyl-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 143013487 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (3S)-5-acetyl-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | CC(=O)N1C[C@H](N)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H13N3O2/c1-7(15)14-6-8(12)11(16)13-9-4-2-3-5-10(9)14/h2-5,8H,6,12H2,1H3,(H,13,16)/t8-/m0/s1 |
| InChIKey | KUOWZDJWAABRRC-QMMMGPOBSA-N |
| XLogP | 0.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |