C18H17N3O3 — CID 118076604
(3S)-5-(4-acetylbenzoyl)-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 118076604) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (3S)-5-(4-acetylbenzoyl)-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | (3S)-5-(4-acetylbenzoyl)-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 118076604 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (3S)-5-(4-acetylbenzoyl)-3-amino-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | CC(=O)c1ccc(C(=O)N2C[C@H](N)C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-11(22)12-6-8-13(9-7-12)18(24)21-10-14(19)17(23)20-15-4-2-3-5-16(15)21/h2-9,14H,10,19H2,1H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | MNLSLWLXLCFFPR-AWEZNQCLSA-N |
| XLogP | 1.82 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |