C12H17NO3 — CID 123215844
3-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenol (PubChem CID 123215844) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenol.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenol |
|---|---|
| PubChem CID | 123215844 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenol |
| SMILES | CC1(C)ON(c2cccc(O)c2)OC1(C)C |
| InChI | InChI=1S/C12H17NO3/c1-11(2)12(3,4)16-13(15-11)9-6-5-7-10(14)8-9/h5-8,14H,1-4H3 |
| InChIKey | HQLQWDRSXYWNFC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |