About 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one
7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one (PubChem CID 105471206) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one.
Molecular Properties
| Compound Name | 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one |
| PubChem CID | 105471206 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one |
| SMILES | Nc1cccc(N2CC3(CCC3)NC2=O)c1 |
| InChI | InChI=1S/C12H15N3O/c13-9-3-1-4-10(7-9)15-8-12(5-2-6-12)14-11(15)16/h1,3-4,7H,2,5-6,8,13H2,(H,14,16) |
| InChIKey | FNGMFBDDEYTHGO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one?
The IUPAC name of 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one (CID 105471206) is 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one.
What is the SMILES notation for 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one?
The canonical SMILES for 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one is Nc1cccc(N2CC3(CCC3)NC2=O)c1.
What is the InChIKey of 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one?
The InChIKey is FNGMFBDDEYTHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c13-9-3-1-4-10(7-9)15-8-12(5-2-6-12)14-11(15)16/h1,3-4,7H,2,5-6,8,13H2,(H,14,16).
What are the key properties of 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one?
7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one has a molecular weight of 217.27 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-aminophenyl)-5,7-diazaspiro[3.4]octan-6-one is sourced from PubChem (CID 105471206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).