C13H18N2OS — CID 702845
(6S)-1-(3-hydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione (PubChem CID 702845) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is (6S)-1-(3-hydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione.
| Compound Name | (6S)-1-(3-hydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 702845 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (6S)-1-(3-hydroxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione |
| SMILES | C[C@H]1CC(C)(C)NC(=S)N1c1cccc(O)c1 |
| InChI | InChI=1S/C13H18N2OS/c1-9-8-13(2,3)14-12(17)15(9)10-5-4-6-11(16)7-10/h4-7,9,16H,8H2,1-3H3,(H,14,17)/t9-/m0/s1 |
| InChIKey | GUAJTXDMGPSQOM-VIFPVBQESA-N |
| XLogP | 2.64 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|