C14H20N2O2S — CID 1201962
(6R)-6-(2,4-dihydroxyphenyl)-1,4,4,6-tetramethyl-1,3-diazinane-2-thione (PubChem CID 1201962) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is (6R)-6-(2,4-dihydroxyphenyl)-1,4,4,6-tetramethyl-1,3-diazinane-2-thione.
| Compound Name | (6R)-6-(2,4-dihydroxyphenyl)-1,4,4,6-tetramethyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 1201962 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (6R)-6-(2,4-dihydroxyphenyl)-1,4,4,6-tetramethyl-1,3-diazinane-2-thione |
| SMILES | CN1C(=S)NC(C)(C)C[C@]1(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H20N2O2S/c1-13(2)8-14(3,16(4)12(19)15-13)10-6-5-9(17)7-11(10)18/h5-7,17-18H,8H2,1-4H3,(H,15,19)/t14-/m1/s1 |
| InChIKey | FXTWMGAPFQYDAE-CQSZACIVSA-N |
| XLogP | 2.30 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|