C20H24N2O3S — CID 7092649
(6S)-6-(2,4-dihydroxyphenyl)-1-(4-methoxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione (PubChem CID 7092649) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (6S)-6-(2,4-dihydroxyphenyl)-1-(4-methoxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione.
| Compound Name | (6S)-6-(2,4-dihydroxyphenyl)-1-(4-methoxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 7092649 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (6S)-6-(2,4-dihydroxyphenyl)-1-(4-methoxyphenyl)-4,4,6-trimethyl-1,3-diazinane-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(C)(C)C[C@@]2(C)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-19(2)12-20(3,16-10-7-14(23)11-17(16)24)22(18(26)21-19)13-5-8-15(25-4)9-6-13/h5-11,23-24H,12H2,1-4H3,(H,21,26)/t20-/m0/s1 |
| InChIKey | UXIXRYICVDUZID-FQEVSTJZSA-N |
| XLogP | 3.88 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|