C16H21N3O2S — CID 10829457
1-(7-methoxy-3,3,4a-trimethyl-1-sulfanylidene-2,4-dihydropyrimido[1,6-a]benzimidazol-5-yl)ethanone (PubChem CID 10829457) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(7-methoxy-3,3,4a-trimethyl-1-sulfanylidene-2,4-dihydropyrimido[1,6-a]benzimidazol-5-yl)ethanone.
| Compound Name | 1-(7-methoxy-3,3,4a-trimethyl-1-sulfanylidene-2,4-dihydropyrimido[1,6-a]benzimidazol-5-yl)ethanone |
|---|---|
| PubChem CID | 10829457 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(7-methoxy-3,3,4a-trimethyl-1-sulfanylidene-2,4-dihydropyrimido[1,6-a]benzimidazol-5-yl)ethanone |
| SMILES | COc1ccc2c(c1)N(C(C)=O)C1(C)CC(C)(C)NC(=S)N21 |
| InChI | InChI=1S/C16H21N3O2S/c1-10(20)18-13-8-11(21-5)6-7-12(13)19-14(22)17-15(2,3)9-16(18,19)4/h6-8H,9H2,1-5H3,(H,17,22) |
| InChIKey | NOUHSVHPMTVWBB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|