C25H23NO4S3 — CID 1007289
methyl 2-(1-acetyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 1007289) has the molecular formula C25H23NO4S3 and a molecular weight of 497.66 g/mol. Its IUPAC name is methyl 2-(1-acetyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-(1-acetyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 1007289 |
| Molecular Formula | C25H23NO4S3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | methyl 2-(1-acetyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)SC(=C2C(=S)C(C)(C)N(C(C)=O)c3ccc(OC)cc32)S1 |
| InChI | InChI=1S/C25H23NO4S3/c1-14(27)26-18-12-11-16(29-4)13-17(18)19(22(31)25(26,2)3)24-32-20(15-9-7-6-8-10-15)21(33-24)23(28)30-5/h6-13H,1-5H3 |
| InChIKey | PILBSTTWRQXHSG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|