C32H29NO3S3 — CID 6275110
ethyl (2E)-5-phenyl-2-[2,2,6-trimethyl-1-(4-methylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate (PubChem CID 6275110) has the molecular formula C32H29NO3S3 and a molecular weight of 571.79 g/mol. Its IUPAC name is ethyl (2E)-5-phenyl-2-[2,2,6-trimethyl-1-(4-methylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl (2E)-5-phenyl-2-[2,2,6-trimethyl-1-(4-methylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 6275110 |
| Molecular Formula | C32H29NO3S3 |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | ethyl (2E)-5-phenyl-2-[2,2,6-trimethyl-1-(4-methylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)S/C(=C2\C(=S)C(C)(C)N(C(=O)c3ccc(C)cc3)c3ccc(C)cc32)S1 |
| InChI | InChI=1S/C32H29NO3S3/c1-6-36-30(35)27-26(21-10-8-7-9-11-21)38-31(39-27)25-23-18-20(3)14-17-24(23)33(32(4,5)28(25)37)29(34)22-15-12-19(2)13-16-22/h7-18H,6H2,1-5H3/b31-25+ |
| InChIKey | OLFZIAPZCMQUBQ-QCKNELIISA-N |
| XLogP | 8.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|