C26H22F3NO4S3 — CID 2066890
ethyl (2Z)-2-[6-methoxy-2,2-dimethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 2066890) has the molecular formula C26H22F3NO4S3 and a molecular weight of 565.66 g/mol. Its IUPAC name is ethyl (2Z)-2-[6-methoxy-2,2-dimethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl (2Z)-2-[6-methoxy-2,2-dimethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 2066890 |
| Molecular Formula | C26H22F3NO4S3 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | ethyl (2Z)-2-[6-methoxy-2,2-dimethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)S/C(=C2/C(=S)C(C)(C)N(C(=O)C(F)(F)F)c3ccc(OC)cc32)S1 |
| InChI | InChI=1S/C26H22F3NO4S3/c1-5-34-22(31)20-19(14-9-7-6-8-10-14)36-23(37-20)18-16-13-15(33-4)11-12-17(16)30(24(32)26(27,28)29)25(2,3)21(18)35/h6-13H,5H2,1-4H3/b23-18- |
| InChIKey | TYRBLGYEXODETF-NKFKGCMQSA-N |
| XLogP | 6.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|