C33H29NO6S3 — CID 3116597
dimethyl 2-[6-ethoxy-2,2-dimethyl-1-(2-phenylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 3116597) has the molecular formula C33H29NO6S3 and a molecular weight of 631.80 g/mol. Its IUPAC name is dimethyl 2-[6-ethoxy-2,2-dimethyl-1-(2-phenylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[6-ethoxy-2,2-dimethyl-1-(2-phenylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 3116597 |
| Molecular Formula | C33H29NO6S3 |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | dimethyl 2-[6-ethoxy-2,2-dimethyl-1-(2-phenylbenzoyl)-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CCOc1ccc2c(c1)C(=C1SC(C(=O)OC)=C(C(=O)OC)S1)C(=S)C(C)(C)N2C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C33H29NO6S3/c1-6-40-20-16-17-24-23(18-20)25(32-42-26(30(36)38-4)27(43-32)31(37)39-5)28(41)33(2,3)34(24)29(35)22-15-11-10-14-21(22)19-12-8-7-9-13-19/h7-18H,6H2,1-5H3 |
| InChIKey | ONILTSMSFPVGQT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|