C27H27NO4S3 — CID 3363015
ethyl 2-(6-methoxy-2,2-dimethyl-1-propanoyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 3363015) has the molecular formula C27H27NO4S3 and a molecular weight of 525.72 g/mol. Its IUPAC name is ethyl 2-(6-methoxy-2,2-dimethyl-1-propanoyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl 2-(6-methoxy-2,2-dimethyl-1-propanoyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 3363015 |
| Molecular Formula | C27H27NO4S3 |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | ethyl 2-(6-methoxy-2,2-dimethyl-1-propanoyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)SC(=C2C(=S)C(C)(C)N(C(=O)CC)c3ccc(OC)cc32)S1 |
| InChI | InChI=1S/C27H27NO4S3/c1-6-20(29)28-19-14-13-17(31-5)15-18(19)21(24(33)27(28,3)4)26-34-22(16-11-9-8-10-12-16)23(35-26)25(30)32-7-2/h8-15H,6-7H2,1-5H3 |
| InChIKey | GUYAAFQOMHMSOL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|