C30H33NO4S3 — CID 4918345
ethyl 2-(1-hexanoyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 4918345) has the molecular formula C30H33NO4S3 and a molecular weight of 567.80 g/mol. Its IUPAC name is ethyl 2-(1-hexanoyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl 2-(1-hexanoyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 4918345 |
| Molecular Formula | C30H33NO4S3 |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | ethyl 2-(1-hexanoyl-6-methoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | CCCCCC(=O)N1c2ccc(OC)cc2C(=C2SC(C(=O)OCC)=C(c3ccccc3)S2)C(=S)C1(C)C |
| InChI | InChI=1S/C30H33NO4S3/c1-6-8-10-15-23(32)31-22-17-16-20(34-5)18-21(22)24(27(36)30(31,3)4)29-37-25(19-13-11-9-12-14-19)26(38-29)28(33)35-7-2/h9,11-14,16-18H,6-8,10,15H2,1-5H3 |
| InChIKey | LXASEDYNDQKQBU-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|