C26H31NO6S3 — CID 5234750
diethyl 2-(7-methoxy-2,2-dimethyl-1-pentanoyl-3-sulfanylidenequinolin-4-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 5234750) has the molecular formula C26H31NO6S3 and a molecular weight of 549.74 g/mol. Its IUPAC name is diethyl 2-(7-methoxy-2,2-dimethyl-1-pentanoyl-3-sulfanylidenequinolin-4-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | diethyl 2-(7-methoxy-2,2-dimethyl-1-pentanoyl-3-sulfanylidenequinolin-4-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 5234750 |
| Molecular Formula | C26H31NO6S3 |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | diethyl 2-(7-methoxy-2,2-dimethyl-1-pentanoyl-3-sulfanylidenequinolin-4-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CCCCC(=O)N1c2cc(OC)ccc2C(=C2SC(C(=O)OCC)=C(C(=O)OCC)S2)C(=S)C1(C)C |
| InChI | InChI=1S/C26H31NO6S3/c1-7-10-11-18(28)27-17-14-15(31-6)12-13-16(17)19(22(34)26(27,4)5)25-35-20(23(29)32-8-2)21(36-25)24(30)33-9-3/h12-14H,7-11H2,1-6H3 |
| InChIKey | FMSUTILRFXFXDS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|