C24H25NO7S3 — CID 124544371
dimethyl 2-[7-methoxy-2,2-dimethyl-1-[(2R)-oxolane-2-carbonyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 124544371) has the molecular formula C24H25NO7S3 and a molecular weight of 535.67 g/mol. Its IUPAC name is dimethyl 2-[7-methoxy-2,2-dimethyl-1-[(2R)-oxolane-2-carbonyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[7-methoxy-2,2-dimethyl-1-[(2R)-oxolane-2-carbonyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 124544371 |
| Molecular Formula | C24H25NO7S3 |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | dimethyl 2-[7-methoxy-2,2-dimethyl-1-[(2R)-oxolane-2-carbonyl]-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C(=S)C(C)(C)N(C(=O)[C@H]3CCCO3)c3cc(OC)ccc32)S1 |
| InChI | InChI=1S/C24H25NO7S3/c1-24(2)19(33)16(23-34-17(21(27)30-4)18(35-23)22(28)31-5)13-9-8-12(29-3)11-14(13)25(24)20(26)15-7-6-10-32-15/h8-9,11,15H,6-7,10H2,1-5H3/t15-/m1/s1 |
| InChIKey | HXEMWEUTPOFKSY-OAHLLOKOSA-N |
| XLogP | 4.08 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|