C28H29NO3S3 — CID 4218985
ethyl 2-(1-butanoyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 4218985) has the molecular formula C28H29NO3S3 and a molecular weight of 523.75 g/mol. Its IUPAC name is ethyl 2-(1-butanoyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl 2-(1-butanoyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 4218985 |
| Molecular Formula | C28H29NO3S3 |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | ethyl 2-(1-butanoyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | CCCC(=O)N1c2cc(C)ccc2C(=C2SC(C(=O)OCC)=C(c3ccccc3)S2)C(=S)C1(C)C |
| InChI | InChI=1S/C28H29NO3S3/c1-6-11-21(30)29-20-16-17(3)14-15-19(20)22(25(33)28(29,4)5)27-34-23(18-12-9-8-10-13-18)24(35-27)26(31)32-7-2/h8-10,12-16H,6-7,11H2,1-5H3 |
| InChIKey | WTJVJEXWLCZGQR-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|