C34H28N2O5S3 — CID 3873805
ethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2,2,8-trimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 3873805) has the molecular formula C34H28N2O5S3 and a molecular weight of 640.81 g/mol. Its IUPAC name is ethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2,2,8-trimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2,2,8-trimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 3873805 |
| Molecular Formula | C34H28N2O5S3 |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.12 |
| IUPAC Name | ethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2,2,8-trimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)SC(=C2C(=S)C(C)(C)N(C(=O)CN3C(=O)c4ccccc4C3=O)c3c(C)cccc32)S1 |
| InChI | InChI=1S/C34H28N2O5S3/c1-5-41-32(40)28-27(20-13-7-6-8-14-20)43-33(44-28)25-23-17-11-12-19(2)26(23)36(34(3,4)29(25)42)24(37)18-35-30(38)21-15-9-10-16-22(21)31(35)39/h6-17H,5,18H2,1-4H3 |
| InChIKey | FZRWCSRYZOLZKM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|