C25H23NO3S3 — CID 3364332
methyl 2-(1-acetyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 3364332) has the molecular formula C25H23NO3S3 and a molecular weight of 481.66 g/mol. Its IUPAC name is methyl 2-(1-acetyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-(1-acetyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 3364332 |
| Molecular Formula | C25H23NO3S3 |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | methyl 2-(1-acetyl-2,2,7-trimethyl-3-sulfanylidenequinolin-4-ylidene)-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)SC(=C2C(=S)C(C)(C)N(C(C)=O)c3cc(C)ccc32)S1 |
| InChI | InChI=1S/C25H23NO3S3/c1-14-11-12-17-18(13-14)26(15(2)27)25(3,4)22(30)19(17)24-31-20(16-9-7-6-8-10-16)21(32-24)23(28)29-5/h6-13H,1-5H3 |
| InChIKey | RGOSDTMWVFMBRF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|