C31H30N2O6S3 — CID 6152770
ethyl (2E)-2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-ethoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate (PubChem CID 6152770) has the molecular formula C31H30N2O6S3 and a molecular weight of 622.79 g/mol. Its IUPAC name is ethyl (2E)-2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-ethoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate.
| Compound Name | ethyl (2E)-2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-ethoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 6152770 |
| Molecular Formula | C31H30N2O6S3 |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | ethyl (2E)-2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-6-ethoxy-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-5-phenyl-1,3-dithiole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)S/C(=C2\C(=S)C(C)(C)N(C(=O)CN3C(=O)CCC3=O)c3ccc(OCC)cc32)S1 |
| InChI | InChI=1S/C31H30N2O6S3/c1-5-38-19-12-13-21-20(16-19)25(28(40)31(3,4)33(21)24(36)17-32-22(34)14-15-23(32)35)30-41-26(18-10-8-7-9-11-18)27(42-30)29(37)39-6-2/h7-13,16H,5-6,14-15,17H2,1-4H3/b30-25+ |
| InChIKey | GQWPEOPQNGVOFN-QCWLDUFUSA-N |
| XLogP | 5.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|