C16H17BrN6O2 — CID 135231485
9-bromo-16-methoxy-N,9-dimethyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,10,14,16-hexaene-5-carboxamide (PubChem CID 135231485) has the molecular formula C16H17BrN6O2 and a molecular weight of 405.26 g/mol. Its IUPAC name is 9-bromo-16-methoxy-N,9-dimethyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,10,14,16-hexaene-5-carboxamide.
| Compound Name | 9-bromo-16-methoxy-N,9-dimethyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,10,14,16-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 135231485 |
| Molecular Formula | C16H17BrN6O2 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 9-bromo-16-methoxy-N,9-dimethyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,10,14,16-hexaene-5-carboxamide |
| SMILES | CNC(=O)c1nnn2c1CC1N(C=NC1(C)Br)c1ccc(OC)cc1-2 |
| InChI | InChI=1S/C16H17BrN6O2/c1-16(17)13-7-12-14(15(24)18-2)20-21-23(12)11-6-9(25-3)4-5-10(11)22(13)8-19-16/h4-6,8,13H,7H2,1-3H3,(H,18,24) |
| InChIKey | JYPVKWJMORGLLZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|