C25H21N5O8 — CID 169257368
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxylate (PubChem CID 169257368) has the molecular formula C25H21N5O8 and a molecular weight of 519.47 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxylate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 169257368 |
| Molecular Formula | C25H21N5O8 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl] 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxylate |
| SMILES | COc1ccc(OC)c(-n2nnc(C(=O)Oc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)c2C)c1 |
| InChI | InChI=1S/C25H21N5O8/c1-12-21(27-28-30(12)16-11-13(36-2)7-9-17(16)37-3)25(35)38-18-6-4-5-14-20(18)24(34)29(23(14)33)15-8-10-19(31)26-22(15)32/h4-7,9,11,15H,8,10H2,1-3H3,(H,26,31,32) |
| InChIKey | XSFQTUXSGWQRTM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|