C38H43N3O9 — CID 134511220
2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]-N-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexyl]acetamide (PubChem CID 134511220) has the molecular formula C38H43N3O9 and a molecular weight of 685.77 g/mol. Its IUPAC name is 2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]-N-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexyl]acetamide.
| Compound Name | 2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]-N-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexyl]acetamide |
|---|---|
| PubChem CID | 134511220 |
| Molecular Formula | C38H43N3O9 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | 2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]-N-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyhexyl]acetamide |
| SMILES | COc1ccc(CCCc2cccc(OCC(=O)NCCCCCCOc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)c2)cc1OC |
| InChI | InChI=1S/C38H43N3O9/c1-47-30-18-16-26(23-32(30)48-2)11-7-10-25-12-8-13-27(22-25)50-24-34(43)39-20-5-3-4-6-21-49-31-15-9-14-28-35(31)38(46)41(37(28)45)29-17-19-33(42)40-36(29)44/h8-9,12-16,18,22-23,29H,3-7,10-11,17,19-21,24H2,1-2H3,(H,39,43)(H,40,42,44) |
| InChIKey | QJBAEVHJSLEABP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|