C25H23N3O7 — CID 166419698
2-(2,6-dioxopiperidin-3-yl)-4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]isoindole-1,3-dione (PubChem CID 166419698) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166419698 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)CCCN2C(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H23N3O7/c1-34-15-7-8-17-14(12-15)4-3-11-27(17)21(30)13-35-19-6-2-5-16-22(19)25(33)28(24(16)32)18-9-10-20(29)26-23(18)31/h2,5-8,12,18H,3-4,9-11,13H2,1H3,(H,26,29,31) |
| InChIKey | UQKKXUORVCAEAJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|