C12H14N4O3 — CID 82198687
1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 82198687) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 82198687 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(-n2nnc(C(N)=O)c2C)c1 |
| InChI | InChI=1S/C12H14N4O3/c1-7-11(12(13)17)14-15-16(7)9-6-8(18-2)4-5-10(9)19-3/h4-6H,1-3H3,(H2,13,17) |
| InChIKey | KCOCNDYVYMXPSS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |