C11H12ClN3O4S — CID 169248208
1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-sulfonyl chloride (PubChem CID 169248208) has the molecular formula C11H12ClN3O4S and a molecular weight of 317.75 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-sulfonyl chloride.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 169248208 |
| Molecular Formula | C11H12ClN3O4S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-sulfonyl chloride |
| SMILES | COc1ccc(OC)c(-n2nnc(S(=O)(=O)Cl)c2C)c1 |
| InChI | InChI=1S/C11H12ClN3O4S/c1-7-11(20(12,16)17)13-14-15(7)9-6-8(18-2)4-5-10(9)19-3/h4-6H,1-3H3 |
| InChIKey | OMQYUNYTHOERQJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |