C22H28N4O5S — CID 169248099
4-tert-butyl-N-[[1-(2,5-dimethoxyphenyl)-5-methyltriazol-4-yl]-hydroxymethyl]benzenesulfonamide (PubChem CID 169248099) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is 4-tert-butyl-N-[[1-(2,5-dimethoxyphenyl)-5-methyltriazol-4-yl]-hydroxymethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[[1-(2,5-dimethoxyphenyl)-5-methyltriazol-4-yl]-hydroxymethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169248099 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-tert-butyl-N-[[1-(2,5-dimethoxyphenyl)-5-methyltriazol-4-yl]-hydroxymethyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(-n2nnc(C(O)NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2C)c1 |
| InChI | InChI=1S/C22H28N4O5S/c1-14-20(23-25-26(14)18-13-16(30-5)9-12-19(18)31-6)21(27)24-32(28,29)17-10-7-15(8-11-17)22(2,3)4/h7-13,21,24,27H,1-6H3 |
| InChIKey | FVHXLOQSBSMQMP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|