C22H25N4O3Re- — CID 169257289
N-(3-tert-butylbenzene-5-id-1-yl)-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide;rhenium (PubChem CID 169257289) has the molecular formula C22H25N4O3Re- and a molecular weight of 579.67 g/mol. Its IUPAC name is N-(3-tert-butylbenzene-5-id-1-yl)-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide;rhenium.
| Compound Name | N-(3-tert-butylbenzene-5-id-1-yl)-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide;rhenium |
|---|---|
| PubChem CID | 169257289 |
| Molecular Formula | C22H25N4O3Re- |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | N-(3-tert-butylbenzene-5-id-1-yl)-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide;rhenium |
| SMILES | COc1ccc(OC)c(-n2nnc(C(=O)Nc3c[c-]cc(C(C)(C)C)c3)c2C)c1.[Re] |
| InChI | InChI=1S/C22H25N4O3.Re/c1-14-20(21(27)23-16-9-7-8-15(12-16)22(2,3)4)24-25-26(14)18-13-17(28-5)10-11-19(18)29-6;/h8-13H,1-6H3,(H,23,27);/q-1; |
| InChIKey | JNKKWZAVMVIEBF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|