C29H39IN4O4 — CID 169247933
N-[3-tert-butyl-5-(7-iodoheptoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 169247933) has the molecular formula C29H39IN4O4 and a molecular weight of 634.56 g/mol. Its IUPAC name is N-[3-tert-butyl-5-(7-iodoheptoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-[3-tert-butyl-5-(7-iodoheptoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 169247933 |
| Molecular Formula | C29H39IN4O4 |
| Molecular Weight | 634.56 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | N-[3-tert-butyl-5-(7-iodoheptoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(-n2nnc(C(=O)Nc3cc(OCCCCCCCI)cc(C(C)(C)C)c3)c2C)c1 |
| InChI | InChI=1S/C29H39IN4O4/c1-20-27(32-33-34(20)25-19-23(36-5)12-13-26(25)37-6)28(35)31-22-16-21(29(2,3)4)17-24(18-22)38-15-11-9-7-8-10-14-30/h12-13,16-19H,7-11,14-15H2,1-6H3,(H,31,35) |
| InChIKey | IYQFZOSQZUREEN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|