C26H34N4O4 — CID 169247970
N-(2-butoxy-5-tert-butylphenyl)-1-(2,6-dimethoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 169247970) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-(2-butoxy-5-tert-butylphenyl)-1-(2,6-dimethoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(2-butoxy-5-tert-butylphenyl)-1-(2,6-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 169247970 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N-(2-butoxy-5-tert-butylphenyl)-1-(2,6-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | CCCCOc1ccc(C(C)(C)C)cc1NC(=O)c1nnn(-c2c(OC)cccc2OC)c1C |
| InChI | InChI=1S/C26H34N4O4/c1-8-9-15-34-20-14-13-18(26(3,4)5)16-19(20)27-25(31)23-17(2)30(29-28-23)24-21(32-6)11-10-12-22(24)33-7/h10-14,16H,8-9,15H2,1-7H3,(H,27,31) |
| InChIKey | NICLOWVEPUBBIS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|