C29H39N5O5 — CID 169248350
N-[5-tert-butyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 169248350) has the molecular formula C29H39N5O5 and a molecular weight of 537.66 g/mol. Its IUPAC name is N-[5-tert-butyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-[5-tert-butyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 169248350 |
| Molecular Formula | C29H39N5O5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | N-[5-tert-butyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(2,5-dimethoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(-n2nnc(C(=O)Nc3cc(C(C)(C)C)ccc3OCCCN3CCOCC3)c2C)c1 |
| InChI | InChI=1S/C29H39N5O5/c1-20-27(31-32-34(20)24-19-22(36-5)9-11-26(24)37-6)28(35)30-23-18-21(29(2,3)4)8-10-25(23)39-15-7-12-33-13-16-38-17-14-33/h8-11,18-19H,7,12-17H2,1-6H3,(H,30,35) |
| InChIKey | FASMPXMQECOSMV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|