C17H19N3O2S — CID 100599629
(5S)-2,5-bis(4-methoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione (PubChem CID 100599629) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (5S)-2,5-bis(4-methoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione.
| Compound Name | (5S)-2,5-bis(4-methoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 100599629 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (5S)-2,5-bis(4-methoxyphenyl)-5-methyl-1,2,4-triazolidine-3-thione |
| SMILES | COc1ccc(N2N[C@@](C)(c3ccc(OC)cc3)NC2=S)cc1 |
| InChI | InChI=1S/C17H19N3O2S/c1-17(12-4-8-14(21-2)9-5-12)18-16(23)20(19-17)13-6-10-15(22-3)11-7-13/h4-11,19H,1-3H3,(H,18,23)/t17-/m0/s1 |
| InChIKey | BSVJJKBTWQXDLM-KRWDZBQOSA-N |
| XLogP | 2.78 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|