C17H19N3OS — CID 35264581
(5R)-5-[(4-methoxyphenyl)methyl]-5-methyl-2-phenyl-1,2,4-triazolidine-3-thione (PubChem CID 35264581) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is (5R)-5-[(4-methoxyphenyl)methyl]-5-methyl-2-phenyl-1,2,4-triazolidine-3-thione.
| Compound Name | (5R)-5-[(4-methoxyphenyl)methyl]-5-methyl-2-phenyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 35264581 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (5R)-5-[(4-methoxyphenyl)methyl]-5-methyl-2-phenyl-1,2,4-triazolidine-3-thione |
| SMILES | COc1ccc(C[C@]2(C)NC(=S)N(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C17H19N3OS/c1-17(12-13-8-10-15(21-2)11-9-13)18-16(22)20(19-17)14-6-4-3-5-7-14/h3-11,19H,12H2,1-2H3,(H,18,22)/t17-/m1/s1 |
| InChIKey | BYRPABIHYGGPJW-QGZVFWFLSA-N |
| XLogP | 2.85 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|