C17H18N4OS — CID 686434
2-[(3S)-3-methyl-1-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]-N-phenylacetamide (PubChem CID 686434) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[(3S)-3-methyl-1-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]-N-phenylacetamide.
| Compound Name | 2-[(3S)-3-methyl-1-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 686434 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(3S)-3-methyl-1-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-yl]-N-phenylacetamide |
| SMILES | C[C@]1(CC(=O)Nc2ccccc2)NC(=S)N(c2ccccc2)N1 |
| InChI | InChI=1S/C17H18N4OS/c1-17(12-15(22)18-13-8-4-2-5-9-13)19-16(23)21(20-17)14-10-6-3-7-11-14/h2-11,20H,12H2,1H3,(H,18,22)(H,19,23)/t17-/m0/s1 |
| InChIKey | ADSICTPXYZSSMM-KRWDZBQOSA-N |
| XLogP | 2.63 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|