C12H16N4OS — CID 118986521
2-(1,3-dimethyl-5-sulfanylidene-1,2,4-triazolidin-3-yl)-N-phenylacetamide (PubChem CID 118986521) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(1,3-dimethyl-5-sulfanylidene-1,2,4-triazolidin-3-yl)-N-phenylacetamide.
| Compound Name | 2-(1,3-dimethyl-5-sulfanylidene-1,2,4-triazolidin-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 118986521 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(1,3-dimethyl-5-sulfanylidene-1,2,4-triazolidin-3-yl)-N-phenylacetamide |
| SMILES | CN1NC(C)(CC(=O)Nc2ccccc2)NC1=S |
| InChI | InChI=1S/C12H16N4OS/c1-12(14-11(18)16(2)15-12)8-10(17)13-9-6-4-3-5-7-9/h3-7,15H,8H2,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | DZFNWBIEHDBKFN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|