C11H11NO3S3 — CID 7041663
(3aR,6aS)-3-(3-hydroxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione (PubChem CID 7041663) has the molecular formula C11H11NO3S3 and a molecular weight of 301.41 g/mol. Its IUPAC name is (3aR,6aS)-3-(3-hydroxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione.
| Compound Name | (3aR,6aS)-3-(3-hydroxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 7041663 |
| Molecular Formula | C11H11NO3S3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | (3aR,6aS)-3-(3-hydroxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
| SMILES | O=S1(=O)C[C@@H]2[C@@H](C1)SC(=S)N2c1cccc(O)c1 |
| InChI | InChI=1S/C11H11NO3S3/c13-8-3-1-2-7(4-8)12-9-5-18(14,15)6-10(9)17-11(12)16/h1-4,9-10,13H,5-6H2/t9-,10-/m1/s1 |
| InChIKey | PZOXVLAOSAAIKU-NXEZZACHSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|