C11H10BrNO2S3 — CID 7041660
(3aR,6aS)-3-(3-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione (PubChem CID 7041660) has the molecular formula C11H10BrNO2S3 and a molecular weight of 364.31 g/mol. Its IUPAC name is (3aR,6aS)-3-(3-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione.
| Compound Name | (3aR,6aS)-3-(3-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 7041660 |
| Molecular Formula | C11H10BrNO2S3 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | (3aR,6aS)-3-(3-bromophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
| SMILES | O=S1(=O)C[C@@H]2[C@@H](C1)SC(=S)N2c1cccc(Br)c1 |
| InChI | InChI=1S/C11H10BrNO2S3/c12-7-2-1-3-8(4-7)13-9-5-18(14,15)6-10(9)17-11(13)16/h1-4,9-10H,5-6H2/t9-,10-/m1/s1 |
| InChIKey | NWJUKTDRHCWACL-NXEZZACHSA-N |
| XLogP | 2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|