C11H10N2O4S3 — CID 3316268
3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione (PubChem CID 3316268) has the molecular formula C11H10N2O4S3 and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione.
| Compound Name | 3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 3316268 |
| Molecular Formula | C11H10N2O4S3 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazole-2-thione |
| SMILES | O=[N+]([O-])c1cccc(N2C(=S)SC3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C11H10N2O4S3/c14-13(15)8-3-1-2-7(4-8)12-9-5-20(16,17)6-10(9)19-11(12)18/h1-4,9-10H,5-6H2 |
| InChIKey | DTCANCRDXOLTOY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|