C11H11N3O5S — CID 43827976
3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one (PubChem CID 43827976) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one.
| Compound Name | 3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 43827976 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3-(3-nitrophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one |
| SMILES | O=C1NC2CS(=O)(=O)CC2N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O5S/c15-11-12-9-5-20(18,19)6-10(9)13(11)7-2-1-3-8(4-7)14(16)17/h1-4,9-10H,5-6H2,(H,12,15) |
| InChIKey | SKWMEDAJVKNPNN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|