C21H15N3O2S — CID 23629013
3-(4-nitrophenyl)-4,5-diphenyl-1H-imidazole-2-thione (PubChem CID 23629013) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-4,5-diphenyl-1H-imidazole-2-thione.
| Compound Name | 3-(4-nitrophenyl)-4,5-diphenyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 23629013 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-(4-nitrophenyl)-4,5-diphenyl-1H-imidazole-2-thione |
| SMILES | O=[N+]([O-])c1ccc(-n2c(-c3ccccc3)c(-c3ccccc3)[nH]c2=S)cc1 |
| InChI | InChI=1S/C21H15N3O2S/c25-24(26)18-13-11-17(12-14-18)23-20(16-9-5-2-6-10-16)19(22-21(23)27)15-7-3-1-4-8-15/h1-14H,(H,22,27) |
| InChIKey | YWBFQDCMFOESRZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|