C24H19N5OS — CID 170908787
11,13-dimethyl-12-[(4-methylphenyl)diazenyl]-5-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 170908787) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 11,13-dimethyl-12-[(4-methylphenyl)diazenyl]-5-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 11,13-dimethyl-12-[(4-methylphenyl)diazenyl]-5-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 170908787 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 11,13-dimethyl-12-[(4-methylphenyl)diazenyl]-5-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | Cc1ccc(/N=N/c2c(C)nc3sc4c(=O)n(-c5ccccc5)cnc4c3c2C)cc1 |
| InChI | InChI=1S/C24H19N5OS/c1-14-9-11-17(12-10-14)27-28-20-15(2)19-21-22(31-23(19)26-16(20)3)24(30)29(13-25-21)18-7-5-4-6-8-18/h4-13H,1-3H3/b28-27+ |
| InChIKey | YSGXQBYTEAFEJY-BYYHNAKLSA-N |
| XLogP | 6.34 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|