C19H9F3IN3OS2 — CID 143487290
11-(1λ3-ioda-3-thiacyclopenta-1,4-dien-4-yl)-5-phenyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 143487290) has the molecular formula C19H9F3IN3OS2 and a molecular weight of 543.33 g/mol. Its IUPAC name is 11-(1λ3-ioda-3-thiacyclopenta-1,4-dien-4-yl)-5-phenyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11-(1λ3-ioda-3-thiacyclopenta-1,4-dien-4-yl)-5-phenyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 143487290 |
| Molecular Formula | C19H9F3IN3OS2 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 542.92 |
| IUPAC Name | 11-(1λ3-ioda-3-thiacyclopenta-1,4-dien-4-yl)-5-phenyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | O=c1c2sc3nc(C4=CI=CS4)cc(C(F)(F)F)c3c2ncn1-c1ccccc1 |
| InChI | InChI=1S/C19H9F3IN3OS2/c20-19(21,22)11-6-12(13-7-23-8-28-13)25-17-14(11)15-16(29-17)18(27)26(9-24-15)10-4-2-1-3-5-10/h1-9H |
| InChIKey | SPBVQRXJEQJYPE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|