C17H17N3OS — CID 734373
3-amino-N-benzyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 734373) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-amino-N-benzyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-benzyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 734373 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-amino-N-benzyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c2c(N)c(C(=O)NCc3ccccc3)sc2n1 |
| InChI | InChI=1S/C17H17N3OS/c1-10-8-11(2)20-17-13(10)14(18)15(22-17)16(21)19-9-12-6-4-3-5-7-12/h3-8H,9,18H2,1-2H3,(H,19,21) |
| InChIKey | TVPQYKDHFUUDKK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |