C12H6F6N4O — CID 144715291
5-phenyldiazenyl-2,4-bis(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 144715291) has the molecular formula C12H6F6N4O and a molecular weight of 336.20 g/mol. Its IUPAC name is 5-phenyldiazenyl-2,4-bis(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-phenyldiazenyl-2,4-bis(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 144715291 |
| Molecular Formula | C12H6F6N4O |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-phenyldiazenyl-2,4-bis(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc(C(F)(F)F)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C12H6F6N4O/c13-11(14,15)8-7(22-21-6-4-2-1-3-5-6)9(23)20-10(19-8)12(16,17)18/h1-5H,(H,19,20,23)/b22-21+ |
| InChIKey | TYCMUUVSOAIEBU-QURGRASLSA-N |
| XLogP | 4.22 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|