C10H8N8O — CID 139216020
7-amino-6-phenyldiazenyl-4H-tetrazolo[1,5-a]pyrimidin-5-one (PubChem CID 139216020) has the molecular formula C10H8N8O and a molecular weight of 256.23 g/mol. Its IUPAC name is 7-amino-6-phenyldiazenyl-4H-tetrazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 7-amino-6-phenyldiazenyl-4H-tetrazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 139216020 |
| Molecular Formula | C10H8N8O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 7-amino-6-phenyldiazenyl-4H-tetrazolo[1,5-a]pyrimidin-5-one |
| SMILES | Nc1c(/N=N/c2ccccc2)c(=O)[nH]c2nnnn12 |
| InChI | InChI=1S/C10H8N8O/c11-8-7(14-13-6-4-2-1-3-5-6)9(19)12-10-15-16-17-18(8)10/h1-5H,11H2,(H,12,15,17,19)/b14-13+ |
| InChIKey | BHYIMNJKUTYBQN-BUHFOSPRSA-N |
| XLogP | 0.81 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|